CAS 94729-09-6 appears in our catalog under these names: Benzbromarone EP Impurity A, (3-Bromo-4-hydroxyphenyl)(2-ethyl-3-benzofuranyl)-methanone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.
(3-bromo-4-hydroxyphenyl)-(2-ethyl-1-benzofuran-3-yl)methanone (CAS 94729-09-6) is a chemical compound with the molecular formula C17H13BrO3 and a molecular weight of 345.2 g/mol. IUPAC name: (3-bromo-4-hydroxyphenyl)-(2-ethyl-1-benzofuran-3-yl)methanone. InChIKey: QXZXBNDIHSUZDF-UHFFFAOYSA-N.
| Molecular formula | C17H13BrO3 |
|---|---|
| Molecular weight | 345.2 g/mol |
| IUPAC name | (3-bromo-4-hydroxyphenyl)-(2-ethyl-1-benzofuran-3-yl)methanone |
| InChIKey | QXZXBNDIHSUZDF-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C=C3)O)Br |
Computed by PubChem (NCBI)