Products 1424356-79-5
CAS 1424356-79-5 is the registry number for (S)-2-((3-(tert-Butyl)-2-hydroxybenzyl)amino)-N,N,3-trimethylbutanamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 500mg.
(2S)-2-[(3-tert-butyl-2-hydroxyphenyl)methylamino]-N,N,3-trimethylbutanamide (CAS 1424356-79-5) is a chemical compound with the molecular formula C18H30N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: (2S)-2-[(3-tert-butyl-2-hydroxyphenyl)methylamino]-N,N,3-trimethylbutanamide. InChIKey: ZWZOGTIRYWBHMQ-HNNXBMFYSA-N.
| Molecular formula | C18H30N2O2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | (2S)-2-[(3-tert-butyl-2-hydroxyphenyl)methylamino]-N,N,3-trimethylbutanamide |
| InChIKey | ZWZOGTIRYWBHMQ-HNNXBMFYSA-N |
| SMILES | CC(C)[C@@H](C(=O)N(C)C)NCC1=C(C(=CC=C1)C(C)(C)C)O |
Computed by PubChem (NCBI)