Products 62196-18-3

CAS 62196-18-3 is the registry number for (10-Amino-decyl)-carbamic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-(10-aminodecyl)carbamate (CAS 62196-18-3) is a chemical compound with the molecular formula C18H30N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: benzyl N-(10-aminodecyl)carbamate. InChIKey: ABRRGZDHHAQCQS-UHFFFAOYSA-N.

Identity
Molecular formulaC18H30N2O2
Molecular weight306.4 g/mol
IUPAC namebenzyl N-(10-aminodecyl)carbamate
InChIKeyABRRGZDHHAQCQS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NCCCCCCCCCCN

Computed by PubChem (NCBI)