CAS 142439-89-2 appears in our catalog under these names: N,N–Diethyl–p–phenylenediamine oxalate salt, N,N-Diethyl-p-phenylenediamine oxalate salt, 95.00%, N,N-DIETHYL-P-PHENYLENEDIAMINE OXALATE &, N1,N1-Diethylbenzene-1,4-diamine oxalate, 90%+(HPLC),RG, 90%+(HPLC),RG. Offered by: GLPBio, Chemat, Sigma-Aldrich. Available pack sizes: 25g, 5g, 250mg, 1g.
4-N,4-N-diethylbenzene-1,4-diamine;oxalic acid (CAS 142439-89-2) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 4-N,4-N-diethylbenzene-1,4-diamine;oxalic acid. InChIKey: GXSUUFAGHVDMCO-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 4-N,4-N-diethylbenzene-1,4-diamine;oxalic acid |
| InChIKey | GXSUUFAGHVDMCO-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)