CAS 1424455-31-1 is the registry number for 2-((4-Iodo-2-nitrophenyl)amino)propane-1,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-iodo-2-nitroanilino)propane-1,3-diol (CAS 1424455-31-1) is a chemical compound with the molecular formula C9H11IN2O4 and a molecular weight of 338.10 g/mol. IUPAC name: 2-(4-iodo-2-nitroanilino)propane-1,3-diol. InChIKey: YAWQBPROTDYNGD-UHFFFAOYSA-N.
| Molecular formula | C9H11IN2O4 |
|---|---|
| Molecular weight | 338.10 g/mol |
| IUPAC name | 2-(4-iodo-2-nitroanilino)propane-1,3-diol |
| InChIKey | YAWQBPROTDYNGD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)[N+](=O)[O-])NC(CO)CO |
Computed by PubChem (NCBI)