CAS 58510-66-0 appears in our catalog under these names: 2’,5’-Dideoxy-5’-iodouridine, 2′,5′-Dideoxy-5′-iodouridine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 2g, 1g, 5g, Get quote.
1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 58510-66-0) is a chemical compound with the molecular formula C9H11IN2O4 and a molecular weight of 338.10 g/mol. IUPAC name: 1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: JYWLLSHCWALPBJ-SHYZEUOFSA-N.
| Molecular formula | C9H11IN2O4 |
|---|---|
| Molecular weight | 338.10 g/mol |
| IUPAC name | 1-[(2R,4S,5S)-4-hydroxy-5-(iodomethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | JYWLLSHCWALPBJ-SHYZEUOFSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CI)O |
Computed by PubChem (NCBI)