CAS 14246-61-8 is the registry number for 4-Chloro-3-phenylisoxazolo[5,4-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3-phenyl-[1,2]oxazolo[5,4-d]pyrimidine (CAS 14246-61-8) is a chemical compound with the molecular formula C11H6ClN3O and a molecular weight of 231.64 g/mol. IUPAC name: 4-chloro-3-phenyl-[1,2]oxazolo[5,4-d]pyrimidine. InChIKey: WCCSUCJRRBZNPD-UHFFFAOYSA-N.
| Molecular formula | C11H6ClN3O |
|---|---|
| Molecular weight | 231.64 g/mol |
| IUPAC name | 4-chloro-3-phenyl-[1,2]oxazolo[5,4-d]pyrimidine |
| InChIKey | WCCSUCJRRBZNPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC3=C2C(=NC=N3)Cl |
Computed by PubChem (NCBI)