CAS 33360-19-9 is the registry number for 7-Chloro-2-phenyloxazolo[5,4-d]pyrimidine 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-2-phenyl-[1,3]oxazolo[5,4-d]pyrimidine (CAS 33360-19-9) is a chemical compound with the molecular formula C11H6ClN3O and a molecular weight of 231.64 g/mol. IUPAC name: 7-chloro-2-phenyl-[1,3]oxazolo[5,4-d]pyrimidine. InChIKey: WGFDYVQGOQQPSJ-UHFFFAOYSA-N.
| Molecular formula | C11H6ClN3O |
|---|---|
| Molecular weight | 231.64 g/mol |
| IUPAC name | 7-chloro-2-phenyl-[1,3]oxazolo[5,4-d]pyrimidine |
| InChIKey | WGFDYVQGOQQPSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)N=CN=C3Cl |
Computed by PubChem (NCBI)