Products 1424939-65-0

CAS 1424939-65-0 is the registry number for Methyl N-propyl-N-(2-(2,4,6-trichlorophenoxy)ethyl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamate (CAS 1424939-65-0) is a chemical compound with the molecular formula C13H16Cl3NO3 and a molecular weight of 340.6 g/mol. IUPAC name: methyl N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamate. InChIKey: HFMWQXNBQUMFSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16Cl3NO3
Molecular weight340.6 g/mol
IUPAC namemethyl N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]carbamate
InChIKeyHFMWQXNBQUMFSZ-UHFFFAOYSA-N
SMILESCCCN(CCOC1=C(C=C(C=C1Cl)Cl)Cl)C(=O)OC

Computed by PubChem (NCBI)