Products 1424943-63-4
CAS 1424943-63-4 is the registry number for N-(2-Benzyl-octahydro-1H-isoindol-4-ylidene)hydroxylamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(NE)-N-(2-benzyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ylidene)hydroxylamine (CAS 1424943-63-4) is a chemical compound with the molecular formula C15H20N2O and a molecular weight of 244.33 g/mol. IUPAC name: (NE)-N-(2-benzyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ylidene)hydroxylamine. InChIKey: YGUBLIFXKQYDAG-FOCLMDBBSA-N.
| Molecular formula | C15H20N2O |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | (NE)-N-(2-benzyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ylidene)hydroxylamine |
| InChIKey | YGUBLIFXKQYDAG-FOCLMDBBSA-N |
| SMILES | C1CC2CN(CC2/C(=N/O)/C1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)