Products 142560-68-7

CAS 142560-68-7 is the registry number for Boc-(1s,2r)-(+)-2-amino-1,2-diphenylethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]carbamate (CAS 142560-68-7) is a chemical compound with the molecular formula C19H23NO3 and a molecular weight of 313.4 g/mol. IUPAC name: tert-butyl N-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]carbamate. InChIKey: BWCGTKNHQHVNQX-SJORKVTESA-N.

Identity
Molecular formulaC19H23NO3
Molecular weight313.4 g/mol
IUPAC nametert-butyl N-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]carbamate
InChIKeyBWCGTKNHQHVNQX-SJORKVTESA-N
SMILESCC(C)(C)OC(=O)N[C@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)O

Computed by PubChem (NCBI)