CAS 543906-09-8 appears in our catalog under these names: Mavoglurant, 95%, Mavoglurant, Mavoglurant, >95% (HPLC), Mavoglurant (AFQ056), Mavoglurant 98%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Ambeed. Available pack sizes: 100mg, on request, 10mg, 25mg, 10mM (in 1ml dmso), 5mg, 50mg, 1mg.
Methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (CAS 543906-09-8) is a chemical compound with the molecular formula C19H23NO3 and a molecular weight of 313.4 g/mol. IUPAC name: methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate. InChIKey: ZFPZEYHRWGMJCV-ZHALLVOQSA-N.
| Molecular formula | C19H23NO3 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| InChIKey | ZFPZEYHRWGMJCV-ZHALLVOQSA-N |
| SMILES | CC1=CC(=CC=C1)C#C[C@@]2(CCC[C@@H]3[C@H]2CCN3C(=O)OC)O |
Computed by PubChem (NCBI)