CAS 14258-23-2 is the registry number for (R)-2,6-Diamino-6-oxohexanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2,6-diamino-6-oxohexanoic acid (CAS 14258-23-2) is a chemical compound with the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. IUPAC name: (2R)-2,6-diamino-6-oxohexanoic acid. InChIKey: YZJSUQQZGCHHNQ-SCSAIBSYSA-N.
| Molecular formula | C6H12N2O3 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (2R)-2,6-diamino-6-oxohexanoic acid |
| InChIKey | YZJSUQQZGCHHNQ-SCSAIBSYSA-N |
| SMILES | C(C[C@H](C(=O)O)N)CC(=O)N |
Computed by PubChem (NCBI)