CAS 7433-32-1 appears in our catalog under these names: L-Homoglutamine, >95% (HPLC), L-Homoglutamine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 25mg, 50mg.
(2S)-2,6-diamino-6-oxohexanoic acid (CAS 7433-32-1) is a chemical compound with the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. IUPAC name: (2S)-2,6-diamino-6-oxohexanoic acid. InChIKey: YZJSUQQZGCHHNQ-BYPYZUCNSA-N.
| Molecular formula | C6H12N2O3 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (2S)-2,6-diamino-6-oxohexanoic acid |
| InChIKey | YZJSUQQZGCHHNQ-BYPYZUCNSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CC(=O)N |
Computed by PubChem (NCBI)