CAS 142592-09-4 appears in our catalog under these names: Lercanidipine Impurity 20, Lercanidipine Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 4-hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate (CAS 142592-09-4) is a chemical compound with the molecular formula C17H19NO8 and a molecular weight of 365.3 g/mol. IUPAC name: dimethyl 4-hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate. InChIKey: WGETYYLVMDBIRH-UHFFFAOYSA-N.
| Molecular formula | C17H19NO8 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | dimethyl 4-hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate |
| InChIKey | WGETYYLVMDBIRH-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(C1C(=O)OC)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC)O |
Computed by PubChem (NCBI)