CAS 89080-61-5 appears in our catalog under these names: Lercanidipine Impurity 39, Dimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
Dimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate (CAS 89080-61-5) is a chemical compound with the molecular formula C17H19NO8 and a molecular weight of 365.3 g/mol. IUPAC name: dimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate. InChIKey: NRZGJFOHXKPBOS-UHFFFAOYSA-N.
| Molecular formula | C17H19NO8 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | dimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate |
| InChIKey | NRZGJFOHXKPBOS-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(C1=CC(=CC=C1)[N+](=O)[O-])C(C(=O)C)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)