Products 89080-61-5

CAS 89080-61-5 appears in our catalog under these names: Lercanidipine Impurity 39, Dimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.

Structural formula: {0} (CAS {1})

Dimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate (CAS 89080-61-5) is a chemical compound with the molecular formula C17H19NO8 and a molecular weight of 365.3 g/mol. IUPAC name: dimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate. InChIKey: NRZGJFOHXKPBOS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO8
Molecular weight365.3 g/mol
IUPAC namedimethyl 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate
InChIKeyNRZGJFOHXKPBOS-UHFFFAOYSA-N
SMILESCC(=O)C(C(C1=CC(=CC=C1)[N+](=O)[O-])C(C(=O)C)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)