CAS 142593-05-3 is the registry number for Methyl 4'–Methyl–2,2'–bipyridine–4–carboxylate. Offered by: GLPBio. Available pack sizes: 250mg.
Methyl 2-(4-methyl-2-pyridinyl)pyridine-4-carboxylate (CAS 142593-05-3) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: methyl 2-(4-methyl-2-pyridinyl)pyridine-4-carboxylate. InChIKey: NCPOJHYXWDWQNL-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | methyl 2-(4-methyl-2-pyridinyl)pyridine-4-carboxylate |
| InChIKey | NCPOJHYXWDWQNL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C2=NC=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)