CAS 1425940-32-4 appears in our catalog under these names: 9–Ethyl–3,6–di(pyridin–4–yl)–9H–carbazole, 9-Ethyl-3,6-di(pyridin-4-yl)-9H-carbazole, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg, 100mg, 250mg.
9-ethyl-3,6-dipyridin-4-ylcarbazole (CAS 1425940-32-4) is a chemical compound with the molecular formula C24H19N3 and a molecular weight of 349.4 g/mol. IUPAC name: 9-ethyl-3,6-dipyridin-4-ylcarbazole. InChIKey: BYFMVJJSMNIBRO-UHFFFAOYSA-N.
| Molecular formula | C24H19N3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 9-ethyl-3,6-dipyridin-4-ylcarbazole |
| InChIKey | BYFMVJJSMNIBRO-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C3=CC=NC=C3)C4=C1C=CC(=C4)C5=CC=NC=C5 |
Computed by PubChem (NCBI)