CAS 1902127-03-0 is the registry number for 4,4'-(9H-Carbazole-2,7-diyl)dianiline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[7-(4-aminophenyl)-9H-carbazol-2-yl]aniline (CAS 1902127-03-0) is a chemical compound with the molecular formula C24H19N3 and a molecular weight of 349.4 g/mol. IUPAC name: 4-[7-(4-aminophenyl)-9H-carbazol-2-yl]aniline. InChIKey: CUVWCOOPBIWAPG-UHFFFAOYSA-N.
| Molecular formula | C24H19N3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 4-[7-(4-aminophenyl)-9H-carbazol-2-yl]aniline |
| InChIKey | CUVWCOOPBIWAPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(C=C2)C4=C(N3)C=C(C=C4)C5=CC=C(C=C5)N)N |
Computed by PubChem (NCBI)