CAS 142601-87-4 appears in our catalog under these names: Allyl l-methioninate 4-methylbenzenesulfonate, 98%, L-Methionine Allyl Ester Tosylate, H-Met-OAll.TosOH, 98%, L–Methionine Allyl Ester Tosylate, H-Met-OAll.TosOH, 98%, 98%. Offered by: Fluorochem, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-amino-4-methylsulfanylbutanoate (CAS 142601-87-4) is a chemical compound with the molecular formula C15H23NO5S2 and a molecular weight of 361.5 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-amino-4-methylsulfanylbutanoate. InChIKey: FBJFDYRGTDWIKF-FJXQXJEOSA-N.
| Molecular formula | C15H23NO5S2 |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-amino-4-methylsulfanylbutanoate |
| InChIKey | FBJFDYRGTDWIKF-FJXQXJEOSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CSCC[C@@H](C(=O)OCC=C)N |
Computed by PubChem (NCBI)