Products 1426021-96-6

CAS 1426021-96-6 is the registry number for (E)-Propiophenone O-acetyl oxime, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

[(E)-1-phenylpropylideneamino] acetate (CAS 1426021-96-6) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: [(E)-1-phenylpropylideneamino] acetate. InChIKey: GQXHAUYORCRJHW-VAWYXSNFSA-N.

Identity
Molecular formulaC11H13NO2
Molecular weight191.23 g/mol
IUPAC name[(E)-1-phenylpropylideneamino] acetate
InChIKeyGQXHAUYORCRJHW-VAWYXSNFSA-N
SMILESCC/C(=N\OC(=O)C)/C1=CC=CC=C1

Computed by PubChem (NCBI)