CAS 14261-92-8 appears in our catalog under these names: APOBEC3G-IN-1, 95+%, APOBEC3G-IN-1/ 96.54% (existing batch purity), APOBEC3G–IN–1, 3-oxo-2-phenyl-2,3-dihydro-1H-isoindole-4-carboxylic acid, 96%, 96%, APOBEC3G-IN-1, 96.88%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 10mg, 25mg, 5mg, 50mg, 10 mg, 25 mg.
3-oxo-2-phenyl-1H-isoindole-4-carboxylic acid (CAS 14261-92-8) is a chemical compound with the molecular formula C15H11NO3 and a molecular weight of 253.25 g/mol. IUPAC name: 3-oxo-2-phenyl-1H-isoindole-4-carboxylic acid. InChIKey: MGTJLBBOVQWHLG-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 3-oxo-2-phenyl-1H-isoindole-4-carboxylic acid |
| InChIKey | MGTJLBBOVQWHLG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)C(=O)O)C(=O)N1C3=CC=CC=C3 |
Computed by PubChem (NCBI)