CAS 142620-97-1 appears in our catalog under these names: {(4-(carboxymethyl)phenyl)methyl}triphenylphosphanium bromide, 95%, {(4-(Carboxymethyl)phenyl)methyl}triphenylphosphanium bromide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
[4-(carboxymethyl)phenyl]methyl-triphenylphosphanium bromide (CAS 142620-97-1) is a chemical compound with the molecular formula C27H24BrO2P and a molecular weight of 491.4 g/mol. IUPAC name: [4-(carboxymethyl)phenyl]methyl-triphenylphosphanium bromide. InChIKey: HPFCLDHQJUNWQD-UHFFFAOYSA-N.
| Molecular formula | C27H24BrO2P |
|---|---|
| Molecular weight | 491.4 g/mol |
| IUPAC name | [4-(carboxymethyl)phenyl]methyl-triphenylphosphanium bromide |
| InChIKey | HPFCLDHQJUNWQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC=C(C=C2)CC(=O)O)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)