CAS 142623-85-6 appears in our catalog under these names: 5-(4-Fluorophenyl)-3-(trifluoromethyl)-1h-pyrazole, 95%, 3-(4-Fluorophenyl)-5-(trifluoromethyl)-1H-pyrazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
3-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazole (CAS 142623-85-6) is a chemical compound with the molecular formula C10H6F4N2 and a molecular weight of 230.16 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazole. InChIKey: NDVPIRBTOQYYHD-UHFFFAOYSA-N.
| Molecular formula | C10H6F4N2 |
|---|---|
| Molecular weight | 230.16 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazole |
| InChIKey | NDVPIRBTOQYYHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)