CAS 33469-12-4 is the registry number for 2–(4–Fluorophenyl)–5–(trifluoromethyl)–1H–imidazole. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-(4-fluorophenyl)-5-(trifluoromethyl)-1H-imidazole (CAS 33469-12-4) is a chemical compound with the molecular formula C10H6F4N2 and a molecular weight of 230.16 g/mol. IUPAC name: 2-(4-fluorophenyl)-5-(trifluoromethyl)-1H-imidazole. InChIKey: JWQVMMHWTAFPQR-UHFFFAOYSA-N.
| Molecular formula | C10H6F4N2 |
|---|---|
| Molecular weight | 230.16 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-5-(trifluoromethyl)-1H-imidazole |
| InChIKey | JWQVMMHWTAFPQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(N2)C(F)(F)F)F |
Computed by PubChem (NCBI)