Products 142648-47-3
CAS 142648-47-3 appears in our catalog under these names: Anti–Heart Failure Agent 1, Anti-heart failure agent 1. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, Get quote.
4-fluoro-N'-hydroxy-5,6-dimethoxy-1-benzothiophene-2-carboximidamide (CAS 142648-47-3) is a chemical compound with the molecular formula C11H11FN2O3S and a molecular weight of 270.28 g/mol. IUPAC name: 4-fluoro-N'-hydroxy-5,6-dimethoxy-1-benzothiophene-2-carboximidamide. InChIKey: JHCWLAVFDAPCMI-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O3S |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 4-fluoro-N'-hydroxy-5,6-dimethoxy-1-benzothiophene-2-carboximidamide |
| InChIKey | JHCWLAVFDAPCMI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C(S2)/C(=N\O)/N)C(=C1OC)F |
Computed by PubChem (NCBI)