Products 1519217-67-4
CAS 1519217-67-4 is the registry number for 2-(1,1-Dioxidotetrahydrothiophen-3-yl)-4-fluoro-1,2-dihydro-3H-indazol-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,1-dioxothiolan-3-yl)-4-fluoro-1H-indazol-3-one (CAS 1519217-67-4) is a chemical compound with the molecular formula C11H11FN2O3S and a molecular weight of 270.28 g/mol. IUPAC name: 2-(1,1-dioxothiolan-3-yl)-4-fluoro-1H-indazol-3-one. InChIKey: XQOLAXBULROFQS-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O3S |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 2-(1,1-dioxothiolan-3-yl)-4-fluoro-1H-indazol-3-one |
| InChIKey | XQOLAXBULROFQS-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C(=O)C3=C(N2)C=CC=C3F |
Computed by PubChem (NCBI)