Products 1426683-30-8
CAS 1426683-30-8 is the registry number for FAK inhibitor 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-ethyl-8-(4-ethylphenyl)-5-methylpyrazolo[4,5-c][2,1]benzothiazine 4,4-dioxide (CAS 1426683-30-8) is a chemical compound with the molecular formula C20H21N3O2S and a molecular weight of 367.5 g/mol. IUPAC name: 1-ethyl-8-(4-ethylphenyl)-5-methylpyrazolo[4,5-c][2,1]benzothiazine 4,4-dioxide. InChIKey: LWMFYSSKMYKGNI-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O2S |
|---|---|
| Molecular weight | 367.5 g/mol |
| IUPAC name | 1-ethyl-8-(4-ethylphenyl)-5-methylpyrazolo[4,5-c][2,1]benzothiazine 4,4-dioxide |
| InChIKey | LWMFYSSKMYKGNI-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC3=C(C=C2)N(S(=O)(=O)C4=C3N(N=C4)CC)C |
Computed by PubChem (NCBI)