CAS 646459-39-4 appears in our catalog under these names: Etoricoxib Impurity 7, N,N,6'-Trimethyl-3-(4-(methylsulfonyl)phenyl)-(2,3'-bipyridin)-5-amine, Etoricoxib impurity 5, Etoricoxib impurity 7, 99.00%, N,N,6'-Trimethyl-3-(4-(methylsulfonyl)phenyl)-[2,3'-bipyridin]-5-amine (Etoricoxib Impurity), 98%. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress, Fluorochem. Available pack sizes: on request, 100mg, 50mg, 25mg, 250mg, 25 mg, 50 mg, 10 mg.
N,N-dimethyl-6-(6-methyl-3-pyridinyl)-5-(4-methylsulfonylphenyl)pyridin-3-amine (CAS 646459-39-4) is a chemical compound with the molecular formula C20H21N3O2S and a molecular weight of 367.5 g/mol. IUPAC name: N,N-dimethyl-6-(6-methyl-3-pyridinyl)-5-(4-methylsulfonylphenyl)pyridin-3-amine. InChIKey: MVGZGZDEQNNYMW-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O2S |
|---|---|
| Molecular weight | 367.5 g/mol |
| IUPAC name | N,N-dimethyl-6-(6-methyl-3-pyridinyl)-5-(4-methylsulfonylphenyl)pyridin-3-amine |
| InChIKey | MVGZGZDEQNNYMW-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=C(C=C(C=N2)N(C)C)C3=CC=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)