Products 1426933-69-8
CAS 1426933-69-8 is the registry number for 2-(Bromomethyl)-5-(trifluoromethyl)benzonitrile, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
2-(bromomethyl)-5-(trifluoromethyl)benzonitrile (CAS 1426933-69-8) is a chemical compound with the molecular formula C9H5BrF3N and a molecular weight of 264.04 g/mol. IUPAC name: 2-(bromomethyl)-5-(trifluoromethyl)benzonitrile. InChIKey: UWXKJMATMNAFCE-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3N |
|---|---|
| Molecular weight | 264.04 g/mol |
| IUPAC name | 2-(bromomethyl)-5-(trifluoromethyl)benzonitrile |
| InChIKey | UWXKJMATMNAFCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C#N)CBr |
Computed by PubChem (NCBI)