CAS 1426958-44-2 is the registry number for N-(4,5-Dibromo-2-methylpyrazol-3-yl)acetamide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(3,4-dibromo-1-methylpyrazol-5-yl)acetamide (CAS 1426958-44-2) is a chemical compound with the molecular formula C6H7Br2N3O and a molecular weight of 296.95 g/mol. IUPAC name: N-(3,4-dibromo-1-methylpyrazol-5-yl)acetamide. InChIKey: YILANIFFONMDAR-UHFFFAOYSA-N.
| Molecular formula | C6H7Br2N3O |
|---|---|
| Molecular weight | 296.95 g/mol |
| IUPAC name | N-(3,4-dibromo-1-methylpyrazol-5-yl)acetamide |
| InChIKey | YILANIFFONMDAR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=NN1C)Br)Br |
Computed by PubChem (NCBI)