CAS 320424-38-2 is the registry number for 3-(3,5-Dibromo-1h-1,2,4-triazol-1-yl)-2-butanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(3,5-dibromo-1,2,4-triazol-1-yl)butan-2-one (CAS 320424-38-2) is a chemical compound with the molecular formula C6H7Br2N3O and a molecular weight of 296.95 g/mol. IUPAC name: 3-(3,5-dibromo-1,2,4-triazol-1-yl)butan-2-one. InChIKey: GPCXQAFMNHJJKX-UHFFFAOYSA-N.
| Molecular formula | C6H7Br2N3O |
|---|---|
| Molecular weight | 296.95 g/mol |
| IUPAC name | 3-(3,5-dibromo-1,2,4-triazol-1-yl)butan-2-one |
| InChIKey | GPCXQAFMNHJJKX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C)N1C(=NC(=N1)Br)Br |
Computed by PubChem (NCBI)