CAS 1427081-81-9 appears in our catalog under these names: Apalutamide Impurity 50, Apalutamide Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-4-(methylcarbamoyl)benzoic acid (CAS 1427081-81-9) is a chemical compound with the molecular formula C9H8FNO3 and a molecular weight of 197.16 g/mol. IUPAC name: 3-fluoro-4-(methylcarbamoyl)benzoic acid. InChIKey: MPTGYTLHMFRIEC-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO3 |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 3-fluoro-4-(methylcarbamoyl)benzoic acid |
| InChIKey | MPTGYTLHMFRIEC-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)