Products 142717-57-5
CAS 142717-57-5 is the registry number for Dihydrocurcumenone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, 5 mg, 1 mg.
(1S,6R,7R)-7-[(3S)-3-hydroxybutyl]-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one (CAS 142717-57-5) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: (1S,6R,7R)-7-[(3S)-3-hydroxybutyl]-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one. InChIKey: OQZCUYXRSFWCJU-ZGFBFQLVSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | (1S,6R,7R)-7-[(3S)-3-hydroxybutyl]-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one |
| InChIKey | OQZCUYXRSFWCJU-ZGFBFQLVSA-N |
| SMILES | C[C@@H](CC[C@@H]1[C@@H]2[C@]1(CC(=O)C(=C(C)C)C2)C)O |
Computed by PubChem (NCBI)