Products 142719-61-7
CAS 142719-61-7 is the registry number for 4'-(3,4-Dimethoxyphenyl)-2,2':6',2''-terpyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,4-dimethoxyphenyl)-2,6-dipyridin-2-ylpyridine (CAS 142719-61-7) is a chemical compound with the molecular formula C23H19N3O2 and a molecular weight of 369.4 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-2,6-dipyridin-2-ylpyridine. InChIKey: QLVQBUWHJTZGAJ-UHFFFAOYSA-N.
| Molecular formula | C23H19N3O2 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-2,6-dipyridin-2-ylpyridine |
| InChIKey | QLVQBUWHJTZGAJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=N4)OC |
Computed by PubChem (NCBI)