Products 38375-15-4
CAS 38375-15-4 is the registry number for 4-(4,6-Di-p-tolyl-1,3,5-triazin-2-yl)benzene-1,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]benzene-1,3-diol (CAS 38375-15-4) is a chemical compound with the molecular formula C23H19N3O2 and a molecular weight of 369.4 g/mol. IUPAC name: 4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]benzene-1,3-diol. InChIKey: IKHILWJRZMGXJT-UHFFFAOYSA-N.
| Molecular formula | C23H19N3O2 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]benzene-1,3-diol |
| InChIKey | IKHILWJRZMGXJT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NC(=N2)C3=C(C=C(C=C3)O)O)C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)