CAS 1427207-52-0 is the registry number for 1-Methyl-4-(2-thioxo-2,3-dihydrothiazol-4-yl)pyridin-1-ium, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1-methylpyridin-1-ium-4-yl)-3H-1,3-thiazole-2-thione (CAS 1427207-52-0) is a chemical compound with the molecular formula C9H9N2S2+ and a molecular weight of 209.3 g/mol. IUPAC name: 4-(1-methylpyridin-1-ium-4-yl)-3H-1,3-thiazole-2-thione. InChIKey: KLYZRPWWEZXDGQ-UHFFFAOYSA-O.
| Molecular formula | C9H9N2S2+ |
|---|---|
| Molecular weight | 209.3 g/mol |
| IUPAC name | 4-(1-methylpyridin-1-ium-4-yl)-3H-1,3-thiazole-2-thione |
| InChIKey | KLYZRPWWEZXDGQ-UHFFFAOYSA-O |
| SMILES | C[N+]1=CC=C(C=C1)C2=CSC(=S)N2 |
Computed by PubChem (NCBI)