CAS 1427207-46-2 appears in our catalog under these names: Ceftaroline Fosamil Impurity 17, Ceftaroline Fosamil Impurity E, Ceftaroline Fosamil Impurity 13, (4-(N-Methylpyridinium-4-yl)-1,3-thiazol-2-yl)thiolate. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
4-(1-methylpyridin-1-ium-4-yl)-1,3-thiazole-2-thiolate (CAS 1427207-46-2) is a chemical compound with the molecular formula C9H8N2S2 and a molecular weight of 208.3 g/mol. IUPAC name: 4-(1-methylpyridin-1-ium-4-yl)-1,3-thiazole-2-thiolate. InChIKey: KLYZRPWWEZXDGQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S2 |
|---|---|
| Molecular weight | 208.3 g/mol |
| IUPAC name | 4-(1-methylpyridin-1-ium-4-yl)-1,3-thiazole-2-thiolate |
| InChIKey | KLYZRPWWEZXDGQ-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=C(C=C1)C2=CSC(=N2)[S-] |
Computed by PubChem (NCBI)