CAS 1427355-88-1 is the registry number for 4-Bromo-6-chloroisoindoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6-chloro-2,3-dihydro-1H-isoindole (CAS 1427355-88-1) is a chemical compound with the molecular formula C8H7BrClN and a molecular weight of 232.50 g/mol. IUPAC name: 4-bromo-6-chloro-2,3-dihydro-1H-isoindole. InChIKey: VORHNJCIGQZFKM-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClN |
|---|---|
| Molecular weight | 232.50 g/mol |
| IUPAC name | 4-bromo-6-chloro-2,3-dihydro-1H-isoindole |
| InChIKey | VORHNJCIGQZFKM-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C(=CC(=C2)Cl)Br |
Computed by PubChem (NCBI)