CAS 1427415-81-3 is the registry number for 6-Bromo-4-chloroisoindoline, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
6-bromo-4-chloro-2,3-dihydro-1H-isoindole (CAS 1427415-81-3) is a chemical compound with the molecular formula C8H7BrClN and a molecular weight of 232.50 g/mol. IUPAC name: 6-bromo-4-chloro-2,3-dihydro-1H-isoindole. InChIKey: VUDOFPSGUXCILZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClN |
|---|---|
| Molecular weight | 232.50 g/mol |
| IUPAC name | 6-bromo-4-chloro-2,3-dihydro-1H-isoindole |
| InChIKey | VUDOFPSGUXCILZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)