CAS 1427378-95-7 appears in our catalog under these names: 2-(3-Chloropyridin-2-yl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(3-Chloropyridin-2-yl)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(3-chloro-2-pyridinyl)-1,3-thiazole-4-carboxylic acid (CAS 1427378-95-7) is a chemical compound with the molecular formula C9H5ClN2O2S and a molecular weight of 240.67 g/mol. IUPAC name: 2-(3-chloro-2-pyridinyl)-1,3-thiazole-4-carboxylic acid. InChIKey: PFQCDHYYSGJDBQ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2S |
|---|---|
| Molecular weight | 240.67 g/mol |
| IUPAC name | 2-(3-chloro-2-pyridinyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | PFQCDHYYSGJDBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=NC(=CS2)C(=O)O)Cl |
Computed by PubChem (NCBI)