Products 1538910-07-4
CAS 1538910-07-4 is the registry number for 2-(5-Chloropyridin-2-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-chloro-2-pyridinyl)-1,3-thiazole-4-carboxylic acid (CAS 1538910-07-4) is a chemical compound with the molecular formula C9H5ClN2O2S and a molecular weight of 240.67 g/mol. IUPAC name: 2-(5-chloro-2-pyridinyl)-1,3-thiazole-4-carboxylic acid. InChIKey: SLHYXGSYMAKOIJ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2S |
|---|---|
| Molecular weight | 240.67 g/mol |
| IUPAC name | 2-(5-chloro-2-pyridinyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | SLHYXGSYMAKOIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)