CAS 1427380-29-7 is the registry number for 2-Oxo-3,4-dihydro-2H-1,3-benzoxazine-6-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-oxo-3,4-dihydro-1,3-benzoxazine-6-sulfonamide (CAS 1427380-29-7) is a chemical compound with the molecular formula C8H8N2O4S and a molecular weight of 228.23 g/mol. IUPAC name: 2-oxo-3,4-dihydro-1,3-benzoxazine-6-sulfonamide. InChIKey: QIRLBBRJGSTLDZ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4S |
|---|---|
| Molecular weight | 228.23 g/mol |
| IUPAC name | 2-oxo-3,4-dihydro-1,3-benzoxazine-6-sulfonamide |
| InChIKey | QIRLBBRJGSTLDZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)S(=O)(=O)N)OC(=O)N1 |
Computed by PubChem (NCBI)