Products 2763157-29-3

CAS 2763157-29-3 is the registry number for 4-(Carboxymethyl)-2-(methylthio)pyrimidine-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(carboxymethyl)-2-methylsulfanylpyrimidine-5-carboxylic acid (CAS 2763157-29-3) is a chemical compound with the molecular formula C8H8N2O4S and a molecular weight of 228.23 g/mol. IUPAC name: 4-(carboxymethyl)-2-methylsulfanylpyrimidine-5-carboxylic acid. InChIKey: ZMBWXLIYCHLJJB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O4S
Molecular weight228.23 g/mol
IUPAC name4-(carboxymethyl)-2-methylsulfanylpyrimidine-5-carboxylic acid
InChIKeyZMBWXLIYCHLJJB-UHFFFAOYSA-N
SMILESCSC1=NC=C(C(=N1)CC(=O)O)C(=O)O

Computed by PubChem (NCBI)