CAS 1427380-94-6 appears in our catalog under these names: 1-(2-Cyclopropyl-1,3-thiazol-5-yl)ethan-1-one hydrobromide, 95%, 1-(2-Cyclopropyl-1,3-thiazol-5-yl)ethan-1-one hydrobromide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(2-cyclopropyl-1,3-thiazol-5-yl)ethanone;hydrobromide (CAS 1427380-94-6) is a chemical compound with the molecular formula C8H10BrNOS and a molecular weight of 248.14 g/mol. IUPAC name: 1-(2-cyclopropyl-1,3-thiazol-5-yl)ethanone;hydrobromide. InChIKey: NZBXQWWIUIVBPL-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNOS |
|---|---|
| Molecular weight | 248.14 g/mol |
| IUPAC name | 1-(2-cyclopropyl-1,3-thiazol-5-yl)ethanone;hydrobromide |
| InChIKey | NZBXQWWIUIVBPL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(S1)C2CC2.Br |
Computed by PubChem (NCBI)