CAS 2060050-99-7 is the registry number for (3-Bromophenyl)(ethyl)(imino)-l6-sulfanone, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(3-bromophenyl)-ethyl-imino-oxo-lambda6-sulfane (CAS 2060050-99-7) is a chemical compound with the molecular formula C8H10BrNOS and a molecular weight of 248.14 g/mol. IUPAC name: (3-bromophenyl)-ethyl-imino-oxo-lambda6-sulfane. InChIKey: ZOCDVQLMBOSZSY-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNOS |
|---|---|
| Molecular weight | 248.14 g/mol |
| IUPAC name | (3-bromophenyl)-ethyl-imino-oxo-lambda6-sulfane |
| InChIKey | ZOCDVQLMBOSZSY-UHFFFAOYSA-N |
| SMILES | CCS(=N)(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)