CAS 1427381-04-1 appears in our catalog under these names: 8-Fluoro-3-methyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-5-one, 95%, 8-Fluoro-3-methyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
8-fluoro-3-methyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (CAS 1427381-04-1) is a chemical compound with the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. IUPAC name: 8-fluoro-3-methyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one. InChIKey: LTKLSCXWRDJWQH-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 8-fluoro-3-methyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| InChIKey | LTKLSCXWRDJWQH-UHFFFAOYSA-N |
| SMILES | CC1CNC2=C(C=CC(=C2)F)C(=O)N1 |
Computed by PubChem (NCBI)