CAS 1427395-88-7 is the registry number for 4-Bromo-6-fluorobenzo[d][1,3]dioxole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6-fluoro-1,3-benzodioxole (CAS 1427395-88-7) is a chemical compound with the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. IUPAC name: 4-bromo-6-fluoro-1,3-benzodioxole. InChIKey: PVKQQOCMXVJSAK-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO2 |
|---|---|
| Molecular weight | 219.01 g/mol |
| IUPAC name | 4-bromo-6-fluoro-1,3-benzodioxole |
| InChIKey | PVKQQOCMXVJSAK-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)F)Br |
Computed by PubChem (NCBI)