CAS 161957-56-8 appears in our catalog under these names: 3-Bromo-2-fluorobenzoic acid, 98%, 3–Bromo–2–fluorobenzoic acid, 3-Bromo-2-fluorobenzoic acid, 97% , 3-Bromo-2-fluorobenzoic Acid, >98.0%(GC)(T), 3-Bromo-2-fluorobenzoic acid. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 0,01kg, 0,025kg, 0,05kg.
3-bromo-2-fluorobenzoic acid (CAS 161957-56-8) is a chemical compound with the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. IUPAC name: 3-bromo-2-fluorobenzoic acid. InChIKey: UVKURTLVTLRSSM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO2 |
|---|---|
| Molecular weight | 219.01 g/mol |
| IUPAC name | 3-bromo-2-fluorobenzoic acid |
| InChIKey | UVKURTLVTLRSSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(=O)O |
Computed by PubChem (NCBI)