CAS 1427433-44-0 appears in our catalog under these names: 5-Bromo-6-fluoro-2-methylbenzo(d)thiazole, 97%, 5-bromo-6-fluoro-2-methyl-1,3-benzothiazole, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100mg, 250mg, 500mg, 1g.
5-bromo-6-fluoro-2-methyl-1,3-benzothiazole (CAS 1427433-44-0) is a chemical compound with the molecular formula C8H5BrFNS and a molecular weight of 246.10 g/mol. IUPAC name: 5-bromo-6-fluoro-2-methyl-1,3-benzothiazole. InChIKey: YXSZLMCYTFFBNF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNS |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 5-bromo-6-fluoro-2-methyl-1,3-benzothiazole |
| InChIKey | YXSZLMCYTFFBNF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2S1)F)Br |
Computed by PubChem (NCBI)